3-azido-2,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl fluoride
Modify Date: 2025-09-26 04:12:57
3-azido-2,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl fluoride structure
|
Common Name | 3-azido-2,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 86414-16-6 | Molecular Weight | 355.06600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6F11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-azido-2,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6F11N3O2 |
|---|---|
| Molecular Weight | 355.06600 |
| Exact Mass | 354.98100 |
| PSA | 76.05000 |
| LogP | 3.31116 |
| InChIKey | LLNAXYXPFLGOOY-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(=O)F |
|
~58%
3-azido-2,3,3-t... CAS#:86414-16-6 |
| Literature: Krespan, Carl G. Journal of Organic Chemistry, 1986 , vol. 51, # 3 p. 326 - 332 |
|
~%
3-azido-2,3,3-t... CAS#:86414-16-6 |
| Literature: Krespan, Carl G. Journal of Organic Chemistry, 1986 , vol. 51, # 3 p. 326 - 332 |
| Propanoyl fluoride,3-azido-2,3,3-trifluoro-2-(heptafluoropropoxy) |
| 3-azido-2-heptafluoropropoxytrifluoropropionyl fluoride |
| 3-azido-2-(heptafluoro-n-propoxy)trifluoropropionyl fluoride |