MC-VC-PAB-NH2 structure
|
Common Name | MC-VC-PAB-NH2 | ||
|---|---|---|---|---|
| CAS Number | 1616727-20-8 | Molecular Weight | 658.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H46N8O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-VC-PAB-NH2MC-vc-PAB-NH2 is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | MC-vc-PAB-NH2 |
|---|
| Description | MC-vc-PAB-NH2 is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C31H46N8O8 |
|---|---|
| Molecular Weight | 658.75 |
| InChIKey | CNKMVFCYQSFWSZ-HOFKKMOUSA-N |
| SMILES | CC(C)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)NCCN)cc1 |