MK-4688
Modify Date: 2025-08-23 19:19:07
MK-4688 structure
|
Common Name | MK-4688 | ||
|---|---|---|---|---|
| CAS Number | 1616428-79-5 | Molecular Weight | 550.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H32ClN7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MK-4688MK-4688 is an efficient inhibitor of the HDM2-p53 protein-protein interaction. |
| Name | MK-4688 |
|---|
| Description | MK-4688 is an efficient inhibitor of the HDM2-p53 protein-protein interaction. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H32ClN7O3 |
|---|---|
| Molecular Weight | 550.05 |
| InChIKey | GFGUGIZFJKDGCL-QPVUZGRASA-N |
| SMILES | CC1CCC(Cn2c(N3CCOC4CCCC43)nc3cc(C4NOC(=O)N4)nc(-c4cncc(Cl)c4)c32)CC1 |