QC-3611 structure
|
Common Name | QC-3611 | ||
|---|---|---|---|---|
| CAS Number | 1613410-75-5 | Molecular Weight | 343.764 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 620.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H14ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.9±31.5 °C | |
Use of QC-3611QC-3611 is a selective inhibitor of JARID1A/1B, which is a target existing in various tumors (JARID1A IC50 = 13 nM ;JARID1B IC50 = 2 nM). QC-3611 is promisingly to be used as an antineoplastic drug. |
| Name | 2-{5-[(4-Chloro-2-methylbenzyl)oxy]-1H-pyrazol-1-yl}isonicotinic acid |
|---|---|
| Synonym | More Synonyms |
| Description | QC-3611 is a selective inhibitor of JARID1A/1B, which is a target existing in various tumors (JARID1A IC50 = 13 nM ;JARID1B IC50 = 2 nM). QC-3611 is promisingly to be used as an antineoplastic drug. |
|---|
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 620.3±55.0 °C at 760 mmHg |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.764 |
| Flash Point | 328.9±31.5 °C |
| Exact Mass | 343.072357 |
| LogP | 4.36 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | PSOBPHXKKHPWMU-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1COc1ccnn1-c1cc(C(=O)O)ccn1 |
| 2-{5-[(4-Chloro-2-Methylphenyl)methoxy]-1h-Pyrazol-1-Yl}pyridine-4-Carboxylic Acid |
| 2-{5-[(4-Chloro-2-methylbenzyl)oxy]-1H-pyrazol-1-yl}isonicotinic acid |
| 4-Pyridinecarboxylic acid, 2-[5-[(4-chloro-2-methylphenyl)methoxy]-1H-pyrazol-1-yl]- |