Diroximel fumarate
Modify Date: 2025-08-25 22:48:48
Diroximel fumarate structure
|
Common Name | Diroximel fumarate | ||
|---|---|---|---|---|
| CAS Number | 1577222-14-0 | Molecular Weight | 255.224 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 441.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H13NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.5±23.2 °C | |
Use of Diroximel fumarateDiroximel fumarate (DRF) is a prodrug of monomethyl fumarate in a controlled-release formulation that rapidly and efficiently converts to MMF in the body[1]. |
| Name | Diroxamel fumarate |
|---|---|
| Synonym | More Synonyms |
| Description | Diroximel fumarate (DRF) is a prodrug of monomethyl fumarate in a controlled-release formulation that rapidly and efficiently converts to MMF in the body[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.0±25.0 °C at 760 mmHg |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.224 |
| Flash Point | 220.5±23.2 °C |
| Exact Mass | 255.074280 |
| LogP | -0.24 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | YIMYDTCOUQIDMT-SNAWJCMRSA-N |
| SMILES | COC(=O)C=CC(=O)OCCN1C(=O)CCC1=O |
| Storage condition | -20℃ |
| ALKS 8700 |
| 2-Butenedioic acid, 2-(2,5-dioxo-1-pyrrolidinyl)ethyl methyl ester, (2E)- |
| MFCD28502263 |
| 2-(2,5-Dioxo-1-pyrrolidinyl)ethyl methyl (2E)-2-butenedioate |
| Diroxamel fumarate |
| Diroximel fumarate |
| RDC-5108 |