HBC 530
Modify Date: 2025-09-13 13:31:39
HBC 530 structure
|
Common Name | HBC 530 | ||
|---|---|---|---|---|
| CAS Number | 156840-13-0 | Molecular Weight | 303.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HBC 530HBC is a green fluorescent protein (GFP) fluorophore-like synthetic dye, with a structurally rigid electron acceptor and a strong electron donor. HBC is used to detect RNA localization[1]. |
| Name | HBC |
|---|
| Description | HBC is a green fluorescent protein (GFP) fluorophore-like synthetic dye, with a structurally rigid electron acceptor and a strong electron donor. HBC is used to detect RNA localization[1]. |
|---|---|
| Related Catalog | |
| In Vitro | HBC is nonfluorescent in solution, but strongly fluoresces upon constraining intramolecular motion[1]. |
| References |
| Molecular Formula | C19H17N3O |
|---|---|
| Molecular Weight | 303.36 |
| InChIKey | DIAVZHWDYXQAFC-PDGQHHTCSA-N |
| SMILES | CN(CCO)c1ccc(C=C(C#N)c2ccc(C#N)cc2)cc1 |