7-Methoxy-6-{3-[4-(2-methoxyphenyl)-1-piperazinyl]propoxy}-3,4-dimethyl-2H-chromen-2-one structure
|
Common Name | 7-Methoxy-6-{3-[4-(2-methoxyphenyl)-1-piperazinyl]propoxy}-3,4-dimethyl-2H-chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 155773-59-4 | Molecular Weight | 452.54 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 632.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C26H32N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.0±31.5 °C | |
Use of 7-Methoxy-6-{3-[4-(2-methoxyphenyl)-1-piperazinyl]propoxy}-3,4-dimethyl-2H-chromen-2-oneEnsaculin free base (KA-672) is a NMDA antagonist and have high affinities to serotonergic 5-HT1A and 5-HT7 receptors, adrenergic α1, and dopaminergic D2 and D3 receptors. Ensaculin free base is a memory-enhancing agent. Ensaculin free base has the potential as an antidementia agent acting on various transmitter systems[1]. |
| Name | Ensaculin |
|---|---|
| Synonym | More Synonyms |
| Description | Ensaculin free base (KA-672) is a NMDA antagonist and have high affinities to serotonergic 5-HT1A and 5-HT7 receptors, adrenergic α1, and dopaminergic D2 and D3 receptors. Ensaculin free base is a memory-enhancing agent. Ensaculin free base has the potential as an antidementia agent acting on various transmitter systems[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 632.0±55.0 °C at 760 mmHg |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.54 |
| Flash Point | 336.0±31.5 °C |
| Exact Mass | 452.231110 |
| LogP | 4.86 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | FQELZLMTAPJJOL-UHFFFAOYSA-N |
| SMILES | COc1cc2oc(=O)c(C)c(C)c2cc1OCCCN1CCN(c2ccccc2OC)CC1 |
| 7-Methoxy-6-{3-[4-(2-methoxyphenyl)-1-piperazinyl]propoxy}-3,4-dimethyl-2H-chromen-2-one |
| 7-methoxy-6-(3-(4-(2-methoxyphenyl)piperazin-1-yl)propoxy)3,4-dimethyl-2H-1-benzopyran-2-one |
| 869PGR00AT |
| 2H-1-Benzopyran-2-one, 7-methoxy-6-[3-[4-(2-methoxyphenyl)-1-piperazinyl]propoxy]-3,4-dimethyl- |
| 7-Methoxy-6-(3-(4-(o-methoxyphenyl)-1-piperazinyl)propoxy)-3,4-dimethylcoumarin. |
| Ensaculin |
| 7339 |
| KA-672 |