Pyroglutamic acid
Modify Date: 2025-08-19 17:13:48
Pyroglutamic acid structure
|
Common Name | Pyroglutamic acid | ||
|---|---|---|---|---|
| CAS Number | 15454-75-8 | Molecular Weight | 129.114 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 453.1±38.0 °C at 760 mmHg | |
| Molecular Formula | C10H10N2O6Zn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.8±26.8 °C | |
| Name | Zinc, bis(5-oxo-L-prolinato-κN1,κO2)-, (T-4) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 453.1±38.0 °C at 760 mmHg |
| Molecular Formula | C10H10N2O6Zn |
| Molecular Weight | 129.114 |
| Flash Point | 227.8±26.8 °C |
| Exact Mass | 129.042587 |
| PSA | 120.88000 |
| LogP | -2.39 |
| Appearance of Characters | NA |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | OWVLYQRCCIEOPF-UHFFFAOYSA-L |
| SMILES | O=C([O-])C1CCC([O-])=N1.O=C1CCC(C(=O)O)N1.[Zn+2] |
| Hazard Codes | C |
|---|
| 5-oxopyrrolidine-2-carboxylic acid |
| H-DL-Pyr-OH |
| 5-OXO-2-PYRROLIDINECARBOXYLIC ACID |
| DL-Pyroglutamic Acid |
| GLP |
| DL-5-Oxoproline |
| DL-Proline, 5-oxo- |
| pidolic acid |
| 2-Oxopyrrolidine-5-carboxylic acid |
| 5-oxo-DL-proline |
| 5-Carboxy-2-pyrrolidinone |
| Pyroglutamic acid |
| Proline, 5-oxo- |
| 2-Pyrrolidone-5-carboxylic acid |
| 5-Oxoproline |