7-Methyl-7,8-dihydroguanosine structure
|
Common Name | 7-Methyl-7,8-dihydroguanosine | ||
|---|---|---|---|---|
| CAS Number | 15313-37-8 | Molecular Weight | 299.283 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H17N5O5 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | N/A | |
| Name | 7-methylguanosine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Molecular Formula | C11H17N5O5 |
| Molecular Weight | 299.283 |
| Exact Mass | 299.122955 |
| PSA | 148.17000 |
| LogP | -0.26 |
| Index of Refraction | 1.860 |
| InChIKey | ZBDDPUHBOFHFRK-UHFFFAOYSA-N |
| SMILES | CN1CN(C2OC(CO)C(O)C2O)c2nc(N)[nH]c(=O)c21 |
| Storage condition | −20°C |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
|
~85%
7-Methyl-7,8-di... CAS#:15313-37-8 |
| Literature: Pagano; Lajewski; Jones Journal of the American Chemical Society, 1995 , vol. 117, # 47 p. 11669 - 11672 |
| 7,8-Dihydroguanosine, 7-methyl- |
| 7-methyl-guanosine |
| 7-Methyl-7,8-dihydroguanosine |
| 7,8-Dihydro-7-methylguanosine |
| N7-methylguanosine |
| 7-methyl-7,8-dihydro-guanosine |