Hemorphin-7
Modify Date: 2025-08-21 16:07:04
Hemorphin-7 structure
|
Common Name | Hemorphin-7 | ||
|---|---|---|---|---|
| CAS Number | 152685-85-3 | Molecular Weight | 997.106 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C49H64N12O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Hemorphin-7Hemorphin-7 is a hemorphin peptide, an endogenous opioid peptide derived from the β-chain of hemoglobin. Hemorphin peptides exhibits antinociceptive and antihypertensive activities, activating opioid receptors and inhibiting angiotensin-converting enzyme (ACE). |
| Name | Hemorphin-7 |
|---|---|
| Synonym | More Synonyms |
| Description | Hemorphin-7 is a hemorphin peptide, an endogenous opioid peptide derived from the β-chain of hemoglobin. Hemorphin peptides exhibits antinociceptive and antihypertensive activities, activating opioid receptors and inhibiting angiotensin-converting enzyme (ACE). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C49H64N12O11 |
| Molecular Weight | 997.106 |
| Exact Mass | 996.481750 |
| LogP | 1.11 |
| Index of Refraction | 1.689 |
| InChIKey | PAJVBIPSWDYNHN-JMJBHNTOSA-N |
| SMILES | CC(O)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C1CCCN1C(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| Storage condition | 2-8℃ |
| L-Phenylalanine, L-tyrosyl-L-prolyl-L-tryptophyl-L-threonyl-L-glutaminyl-N5-(diaminomethylene)-L-ornithyl- |
| L-Phenylalanine, L-tyrosyl-L-prolyl-L-tryptophyl-L-threonyl-L-glutaminyl-L-arginyl- |
| L-Tyrosyl-L-prolyl-L-tryptophyl-L-threonyl-L-glutaminyl-L-arginyl-L-phenylalanine |
| L-Tyrosyl-L-prolyl-L-tryptophyl-L-threonyl-L-glutaminyl-N5-(diaminomethylene)-L-ornithyl-L-phenylalanine |