6-Methoxy-5-nitro-1H-indazole
6-Methoxy-5-nitro-1H-indazole structure
|
Common Name | 6-Methoxy-5-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 152626-75-0 | Molecular Weight | 193.160 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 426.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C8H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7±23.2 °C | |
| Name | 6-Methoxy-5-nitro-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 426.5±25.0 °C at 760 mmHg |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.160 |
| Flash Point | 211.7±23.2 °C |
| Exact Mass | 193.048737 |
| PSA | 83.73000 |
| LogP | 1.81 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.686 |
| InChIKey | QULAONDBWZZTOI-UHFFFAOYSA-N |
| SMILES | COc1cc2[nH]ncc2cc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
6-Methoxy-5-nit... CAS#:152626-75-0 |
| Literature: US2012/15962 A1, ; Page/Page column 89-90 ; US 20120015962 A1 |
|
~%
6-Methoxy-5-nit... CAS#:152626-75-0 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 12, # 9 p. 2115 - 2137 |
|
~%
6-Methoxy-5-nit... CAS#:152626-75-0 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 12, # 9 p. 2115 - 2137 |
|
~%
6-Methoxy-5-nit... CAS#:152626-75-0 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 12, # 9 p. 2115 - 2137 |
|
~%
6-Methoxy-5-nit... CAS#:152626-75-0 |
| Literature: US2012/15962 A1, ; US 20120015962 A1 |
|
~%
6-Methoxy-5-nit... CAS#:152626-75-0 |
| Literature: Journal of the Chemical Society, , p. 2412,2419 |
CAS#:749223-61-8| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Methoxy-5-nitro-1H-indazole |
| RW3722 |
| 6-methoxy-5-nitroindazole |
| 1H-Indazole, 6-methoxy-5-nitro- |