Perfluoro-3,6,9-trioxadecanoic acid
Modify Date: 2025-09-15 15:17:05
Perfluoro-3,6,9-trioxadecanoic acid structure
|
Common Name | Perfluoro-3,6,9-trioxadecanoic acid | ||
|---|---|---|---|---|
| CAS Number | 151772-59-7 | Molecular Weight | 412.05900 | |
| Density | 1.8g/cm3 | Boiling Point | 247.8ºC at 760mmHg | |
| Molecular Formula | C7HF13O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.7ºC | |
| Name | Perfluoro-3,6,9-trioxadecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8g/cm3 |
|---|---|
| Boiling Point | 247.8ºC at 760mmHg |
| Molecular Formula | C7HF13O5 |
| Molecular Weight | 412.05900 |
| Flash Point | 103.7ºC |
| Exact Mass | 411.96200 |
| PSA | 64.99000 |
| LogP | 3.60460 |
| Vapour Pressure | 0.00806mmHg at 25°C |
| Index of Refraction | 1.303 |
| InChIKey | GNQWOKPKDHCUSB-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| RIDADR | UN 3265 |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]acetic acid |