Retigabine dihydrochloride
Modify Date: 2025-08-24 05:42:21
Retigabine dihydrochloride structure
|
Common Name | Retigabine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 150812-13-8 | Molecular Weight | 376.253 | |
| Density | N/A | Boiling Point | 430ºC at 760 mmHg | |
| Molecular Formula | C16H20Cl2FN3O2 | Melting Point | 168-170ºC | |
| MSDS | N/A | Flash Point | 213.9ºC | |
Use of Retigabine dihydrochlorideRetigabine 2Hcl (Ezogabine; D23129) is a Kv7.2-7.5 (KCNQ2-5) neuronal potassium channel opener witrh anticonvulsant activity. |
| Name | Retigabine dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 430ºC at 760 mmHg |
|---|---|
| Melting Point | 168-170ºC |
| Molecular Formula | C16H20Cl2FN3O2 |
| Molecular Weight | 376.253 |
| Flash Point | 213.9ºC |
| Exact Mass | 375.091675 |
| PSA | 76.38000 |
| LogP | 5.91960 |
| Vapour Pressure | 1.34E-07mmHg at 25°C |
| InChIKey | WSGFOWNASITQHJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)cc1N.Cl.Cl |
| Storage condition | 2-8°C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethyl (2-amino-4-((4-fluorobenzyl)amino)phenyl)carbamate dihydrochloride |
| Carbamic acid, N-[2-amino-4-[[(4-fluorophenyl)methyl]amino]phenyl]-, ethyl ester, hydrochloride (1:2) |
| Ethyl {2-amino-4-[(4-fluorobenzyl)amino]phenyl}carbamate dihydrochloride |
| ethyl N-[2-amino-4-[(4-fluorophenyl)methylamino]phenyl]carbamate,dihydrochloride |
| Ethyl 4-(4-fluorobenzylamino)-2-aminophenylcarbamate dihydrochloride |