Retigabine-d4 Dihydrochloride
Modify Date: 2025-08-29 08:24:49
Retigabine-d4 Dihydrochloride structure
|
Common Name | Retigabine-d4 Dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1285886-70-5 | Molecular Weight | 303.3314232 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18FN3O2 | Melting Point | >183°C (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Retigabine-d4 Dihydrochloride |
|---|
| Melting Point | >183°C (dec.) |
|---|---|
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.3314232 |
| Appearance of Characters | Solid | White to Off-White |
| InChIKey | PCOBBVZJEWWZFR-ZBJDZAJPSA-N |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(F)cc2)cc1N |
| Storage condition | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| Stability | Hygroscopic |
| Water Solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |