calyxamine B structure
|
Common Name | calyxamine B | ||
|---|---|---|---|---|
| CAS Number | 150710-72-8 | Molecular Weight | 195.30 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 270.0±15.0 °C at 760 mmHg | |
| Molecular Formula | C12H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 91.3±20.5 °C | |
Use of calyxamine BCalyxamine B is a piperidine alkaloid that can be isolated from Calyx podatypa[1]. |
| Name | 1-(2,2,6,6-Tetramethyl-4-piperidinylidene)acetone |
|---|---|
| Synonym | More Synonyms |
| Description | Calyxamine B is a piperidine alkaloid that can be isolated from Calyx podatypa[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 270.0±15.0 °C at 760 mmHg |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.30 |
| Flash Point | 91.3±20.5 °C |
| Exact Mass | 195.162308 |
| PSA | 29.10000 |
| LogP | 2.37 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | IIIRMHBNGRZGTN-UHFFFAOYSA-N |
| SMILES | CC(=O)C=C1CC(C)(C)NC(C)(C)C1 |
| Hazard Codes | Xi |
|---|
| 1-(2,2,6,6-Tetramethyl-4-piperidinylidene)acetone |
| calyxamine B |
| 2-Propanone, 1-(2,2,6,6-tetramethyl-4-piperidinylidene)- |