ARN14988
Modify Date: 2025-11-29 16:32:35
ARN14988 structure
|
Common Name | ARN14988 | ||
|---|---|---|---|---|
| CAS Number | 1502027-70-4 | Molecular Weight | 373.832 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H24ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ARN14988ARN14988 is a potent inhibitor of acid ceramidase (ACDase) (IC50=12.8 nM for the human enzyme)[1]. |
| Name | ARN14988 |
|---|---|
| Synonym | More Synonyms |
| Description | ARN14988 is a potent inhibitor of acid ceramidase (ACDase) (IC50=12.8 nM for the human enzyme)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H24ClN3O5 |
| Molecular Weight | 373.832 |
| Exact Mass | 373.140442 |
| LogP | 2.38 |
| Index of Refraction | 1.542 |
| InChIKey | PBVLSEVDIRSYGE-UHFFFAOYSA-N |
| SMILES | CCCCCCNC(=O)n1cc(Cl)c(=O)n(C(=O)OCC(C)C)c1=O |
| ARN14988 |
| 1(2H)-Pyrimidinecarboxylic acid, 5-chloro-3-[(hexylamino)carbonyl]-3,6-dihydro-2,6-dioxo-, 2-methylpropyl ester |
| Isobutyl 5-chloro-3-(hexylcarbamoyl)-2,6-dioxo-3,6-dihydro-1(2H)-pyrimidinecarboxylate |