19-Norergosta-5,7,9-trien-3-ol,acetate, (3b)- (9CI) structure
|
Common Name | 19-Norergosta-5,7,9-trien-3-ol,acetate, (3b)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 15019-43-9 | Molecular Weight | 424.65800 | |
| Density | 1.02g/cm3 | Boiling Point | 507.2ºC at 760mmHg | |
| Molecular Formula | C29H44O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.5ºC | |
| Name | 19-nor-ergostatrien-(5.7.9)-yl-(3Beta)-acetate |
|---|
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 507.2ºC at 760mmHg |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.65800 |
| Flash Point | 257.5ºC |
| Exact Mass | 424.33400 |
| PSA | 26.30000 |
| LogP | 7.26150 |
| Vapour Pressure | 2.07E-10mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | KREGYMYHIDTTHK-CGSRURIWSA-N |
| SMILES | CC(=O)OC1CCc2c(ccc3c2CCC2(C)C3CCC2C(C)CCC(C)C(C)C)C1 |
|
~%
19-Norergosta-5... CAS#:15019-43-9 |
| Literature: Marker; Shabica Journal of the American Chemical Society, 1942 , vol. 64, p. 721 |
|
~%
19-Norergosta-5... CAS#:15019-43-9 |
| Literature: Marker; Shabica Journal of the American Chemical Society, 1942 , vol. 64, p. 721 |
|
~%
19-Norergosta-5... CAS#:15019-43-9 |
| Literature: Marker; Shabica Journal of the American Chemical Society, 1942 , vol. 64, p. 721 |
|
~%
19-Norergosta-5... CAS#:15019-43-9 |
| Literature: Windaus; Roosen-Runge Chemische Berichte, 1940 , vol. 73, p. 321,324 |