Chloramine-T hydrate
Modify Date: 2025-08-24 11:55:05
Chloramine-T hydrate structure
|
Common Name | Chloramine-T hydrate | ||
|---|---|---|---|---|
| CAS Number | 149358-73-6 | Molecular Weight | 245.65900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9ClNNaO3S | Melting Point | 167-170 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS07, GHS08 |
Signal Word | Danger | |
| Name | sodium,chloro-(4-methylphenyl)sulfonylazanide,hydrate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 167-170 °C (dec.)(lit.) |
|---|---|
| Molecular Formula | C7H9ClNNaO3S |
| Molecular Weight | 245.65900 |
| Exact Mass | 244.98900 |
| PSA | 51.75000 |
| LogP | 3.22770 |
| InChIKey | BXSDMMPOQRECKB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)[N-]Cl)cc1.O.[Na+] |
| Storage condition | 2-8°C |
| Symbol |
GHS05, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314-H334 |
| Supplemental HS | Contact with acids liberates toxic gas. |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Hazard Codes | C |
| Risk Phrases | 22-31-34-42 |
| Safety Phrases | 7-22-26-36/37/39-45 |
| RIDADR | UN 3263 8/PG 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Catalytic asymmetric aminohydroxylation provides a short taxol side-chain synthesis.
Acta Chem. Scand. 50 , 649, (1996) The p-toluenesulfonamide derivate of the C-13 side-chain of taxol was prepared on a one third mole scale in a single step from methyl cinnamate. The process employed is catalytic asymmetric aminohydro... |
|
|
Silica-water reaction media: its application to the formation and ring opening of aziridines.
Angew. Chem. Int. Ed. Engl. 43 , 79, (2004)
|
|
|
Heteropoly acid as a novel nitrene transfer agent: a facile and practical aziridination of olefins with Chloramine-T.
Chem. Commun. (Camb.) , 1026, (2004) Environmentally benign HPA is found to be an efficient catalyst for aziridination of olefins in the presence of inexpensive Chloramine-T as a nitrogen source: instantaneous at room temperature, requir... |
| N-Chloro-p-toluenesulfonamide sodium salt hydrate |
| Chloramine-T hydrate |
| chloramine T hydrate |
| MFCD00149065 |
| I05-3375 |
| EINECS 204-854-7 |
| N-Chloro-4-methylbenzenesulfonamide sodium salt hydrate |