osmanthuside H structure
|
Common Name | osmanthuside H | ||
|---|---|---|---|---|
| CAS Number | 149155-70-4 | Molecular Weight | 432.419 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 732.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H28O11 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 396.6±32.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | MFCD24849382 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 732.2±60.0 °C at 760 mmHg |
| Molecular Formula | C19H28O11 |
| Molecular Weight | 432.419 |
| Flash Point | 396.6±32.9 °C |
| Exact Mass | 432.163147 |
| LogP | 0.46 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | IVRQZYXJBVMHCW-OTCFHACESA-N |
| SMILES | OCC1(O)COC(OCC2OC(OCCc3ccc(O)cc3)C(O)C(O)C2O)C1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
[Studies on chemical constituents from stem barks of Fraxinus paxiana].
Zhongguo Zhong Yao Za Zhi 33(16) , 1990-3, (2008) To investigate the chemical constituents of Fraxinus paxiana.The chemical constituents were isolated and purified by chromatographic techniques and the structures of the compounds were identified with... |
|
|
Phenylethanoid glycosides from Osmanthus asiaticus.
Phytochemistry 32(6) , 1553-5, (1993) Three new phenylethanoid glycosides, 2-(4-hydroxyphenyl)ethyl-beta-D-apiosyl-(1----6)-beta-D-glucopy ranoside(osmanthuside H), 2-(4-hydroxyphenyl)ethyl 5-O-trans-p-coumaroyl-beta-D-apiosyl(1----6)-bet... |
| β-D-Glucopyranoside, 2-(4-hydroxyphenyl)ethyl 6-O-[(2R,3R,4R)-tetrahydro-3,4-dihydroxy-4-(hydroxymethyl)-2-furanyl]- |
| Osmanthuside H |
| 2-(4-Hydroxyphenyl)ethyl 6-O-[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)tetrahydro-2-furanyl]-β-D-glucopyranoside |
| MFCD24849382 |