[(p-Chlorobenzyl)Oxy] Trimethylsilane structure
|
Common Name | [(p-Chlorobenzyl)Oxy] Trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 14856-74-7 | Molecular Weight | 214.76400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15ClOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-chlorophenyl)methoxy-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15ClOSi |
|---|---|
| Molecular Weight | 214.76400 |
| Exact Mass | 214.05800 |
| PSA | 9.23000 |
| LogP | 3.69150 |
| InChIKey | NZPAKJILUKYAQV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCc1ccc(Cl)cc1 |
| Storage condition | 2~8℃,Seal |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2931900090 |
| Precursor 8 | |
|---|---|
| DownStream 7 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-Cl-Ph-CH2OTMS |
| 4-Cl-C6H4CH2OTMS |
| p-ClC6H4CH2OTMS |
| 4-Cl-C6H4CH2OSiMe3 |
| 4-chlorobenzyl trimethylsilyl ether |
| trimethylsilyl 4-chlorobenzyl ether |
| [(p-Chlorobenzyl)Oxy] Trimethylsilane |