Eptifibatide Acetate
Modify Date: 2025-08-22 14:56:33
Eptifibatide Acetate structure
|
Common Name | Eptifibatide Acetate | ||
|---|---|---|---|---|
| CAS Number | 148031-34-9 | Molecular Weight | 831.962 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C35H49N11O9S2 | Melting Point | 92-98 °C | |
| MSDS | Chinese | Flash Point | N/A | |
Use of Eptifibatide AcetateEptifibatide, also co-promoted by Schering-Plough/Essex, is an antiplatelet drug of the glycoprotein IIb/IIIa inhibitor class. Eptifibatide is a cyclic heptapeptide derived from a protein found in the venom of the southeastern pygmy rattlesnake (Sistrurus miliarius barbouri). It belongs to the class of the arginin-glycin-aspartat-mimetics and reversibly binds to platelets. Eptifibatide has a short half-life. The drug is the third inhibitor of GPIIb/IIIa that has found broad acceptance after the specific antibody abciximab and the non-peptide tirofiban entered the global market. |
| Name | Eptifibatide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Melting Point | 92-98 °C |
| Molecular Formula | C35H49N11O9S2 |
| Molecular Weight | 831.962 |
| Exact Mass | 831.315613 |
| PSA | 374.49000 |
| LogP | -4.84 |
| Index of Refraction | 1.735 |
| InChIKey | CZKPOZZJODAYPZ-UHFFFAOYSA-N |
| SMILES | NC(=O)C1CSSCCC(=O)NC(CCCCN=C(N)N)C(=O)NCC(=O)NC(CC(=O)O)C(=O)NC(Cc2c[nH]c3ccccc23)C(=O)N2CCCC2C(=O)N1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi,Xn |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . R22:Harmful if swallowed. |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| n6-(aminoiminomethyl)-n2-(3-mercapto-1-oxopropyl-l-lysylglycyl-l-a-aspartyl-l-tryptophyl-l-prolyl-l-cysteinamide |
| 7H-Pyrrolo[2,1-g][1,2,5,8,11,14,17,20]dithiahexaazacyclotricosine-17-acetic acid, 3-(aminocarbonyl)-11-[4-[(aminoiminomethyl)amino]butyl]docosahydro-20-(1H-indol-3-ylmethyl)-1,9,12,15,18,21-hexaoxo- |
| Mpr-Harg-Gly-Asp-Trp-Pro-Cys-NH2,( Disulfide Bridge:1-7) |
| EFTIFIBATIDE |
| MAP-LYS-GLY-ASP-TRP-PRO-CYS-NH2 |
| MFCD05662245 |
| [11-(4-Carbamimidamidobutyl)-3-carbamoyl-20-(1H-indol-3-ylmethyl)-1,9,12,15,18,21-hexaoxodocosahydro-7H-pyrrolo[2,1-g][1,2,5,8,11,14,17,20]dithiahexaazacyclotricosin-17-yl]acetic acid |
| Mpr-Harg-Gly-Asp-Trp-Pro-Cys-NH2,( Disulfide Bridg on Mpr and Cys) |
| Eptifitide |
| INTEGRELIN |
| Eptifibatide Acetate |
| 7H-pyrrolo[2,1-g][1,2,5,8,11,14,17,20]dithiahexaazacyclotricosine-17-acetic acid, 3-(aminocarbonyl)-11-[4-[(diaminomethylene)amino]butyl]docosahydro-20-(1H-indol-3-ylmethyl)-1,9,12,15,18,21-hexaoxo- |