[1,1'-Biphenyl]-4-ol,4-acetate structure
|
Common Name | [1,1'-Biphenyl]-4-ol,4-acetate | ||
|---|---|---|---|---|
| CAS Number | 148-86-7 | Molecular Weight | 212.24400 | |
| Density | 1.103g/cm3 | Boiling Point | 196 °C (13 mmHg) | |
| Molecular Formula | C14H12O2 | Melting Point | 87-89 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 196°C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-acetoxybiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 196 °C (13 mmHg) |
| Melting Point | 87-89 °C(lit.) |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Flash Point | 196°C |
| Exact Mass | 212.08400 |
| PSA | 26.30000 |
| LogP | 3.27890 |
| Vapour Pressure | 0.000141mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | MISFQCBPASYYGV-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(-c2ccccc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2915390090 |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 4-Biphenylyl acetate |
| 4-Phenylphenol Acetate |
| MFCD00014979 |
| (4-phenylphenyl) acetate |
| 4-Acetoxybiphenyl |
| Acetic Acid 4-Biphenyl Ester |
| 4-Biphenyl Acetate |