[1,1'-Biphenyl]-4-ol,4-benzenesulfonate structure
|
Common Name | [1,1'-Biphenyl]-4-ol,4-benzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 32337-48-7 | Molecular Weight | 310.36700 | |
| Density | 1.249g/cm3 | Boiling Point | 484ºC at 760 mmHg | |
| Molecular Formula | C18H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.5ºC | |
| Name | (4-phenylphenyl) benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 484ºC at 760 mmHg |
| Molecular Formula | C18H14O3S |
| Molecular Weight | 310.36700 |
| Flash Point | 246.5ºC |
| Exact Mass | 310.06600 |
| PSA | 51.75000 |
| LogP | 5.20210 |
| Index of Refraction | 1.615 |
| InChIKey | HHZMCOMNTKMOPN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1ccc(-c2ccccc2)cc1)c1ccccc1 |
|
~%
[1,1'-Biphenyl]... CAS#:32337-48-7 |
| Literature: Hazlet Journal of the American Chemical Society, 1937 , vol. 59, p. 287 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Biphenyl-4-yl-benzolsulfonat |
| Benzolsulfonsaeure-biphenyl-4-ylester |
| biphenyl-4-yl benzenesulfonate |
| benzenesulfonic acid biphenyl-4-yl ester |