4-fluoro-2-methyl-6-nitrobenzenamine
Modify Date: 2025-09-29 08:09:59
4-fluoro-2-methyl-6-nitrobenzenamine structure
|
Common Name | 4-fluoro-2-methyl-6-nitrobenzenamine | ||
|---|---|---|---|---|
| CAS Number | 147285-87-8 | Molecular Weight | 170.14100 | |
| Density | 1.371g/cm3 | Boiling Point | 312.1ºC at 760mmHg | |
| Molecular Formula | C7H7FN2O2 | Melting Point | 98-100ºC | |
| MSDS | N/A | Flash Point | 142.6ºC | |
| Name | 4-fluoro-2-methyl-6-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 312.1ºC at 760mmHg |
| Melting Point | 98-100ºC |
| Molecular Formula | C7H7FN2O2 |
| Molecular Weight | 170.14100 |
| Flash Point | 142.6ºC |
| Exact Mass | 170.04900 |
| PSA | 71.84000 |
| LogP | 2.72890 |
| Vapour Pressure | 0.00054mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | RQJZBCXRJPJGGV-UHFFFAOYSA-N |
| SMILES | Cc1cc(F)cc([N+](=O)[O-])c1N |
| Hazard Codes | T: Toxic; |
|---|---|
| HS Code | 2921430090 |
|
~%
4-fluoro-2-meth... CAS#:147285-87-8 |
| Literature: WO2013/148603 A1, ; |
|
~%
4-fluoro-2-meth... CAS#:147285-87-8 |
| Literature: WO2013/148603 A1, ; |
|
~%
4-fluoro-2-meth... CAS#:147285-87-8 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 2 p. 257 - 262 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine,4-fluoro-2-methyl-6-nitro |
| 2-Amino-5-fluoro-3-nitrotoluene |
| 4-fluoro-2-nitro-6-methylaniline |