Bletilol B
Modify Date: 2025-11-27 17:46:24
Bletilol B structure
|
Common Name | Bletilol B | ||
|---|---|---|---|---|
| CAS Number | 147235-17-4 | Molecular Weight | 462.49 | |
| Density | N/A | Boiling Point | 650.1±55.0 °C(Predicted) | |
| Molecular Formula | C27H26O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bletilol BBletilol B is a natural compound that could be found in Bletilla striata[1]. |
| Name | Bletilol B |
|---|
| Description | Bletilol B is a natural compound that could be found in Bletilla striata[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 650.1±55.0 °C(Predicted) |
|---|---|
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.49 |
| InChIKey | QDTMSPUGALRFKA-CCLHPLFOSA-N |
| SMILES | COc1cc(C2COc3cc(OC)c4c(c3C2OC(C)=O)CCc2cc(O)ccc2-4)ccc1O |
| Hazard Codes | Xi |
|---|