triptobenzene H
Modify Date: 2025-08-25 16:52:06
triptobenzene H structure
|
Common Name | triptobenzene H | ||
|---|---|---|---|---|
| CAS Number | 146900-55-2 | Molecular Weight | 344.44 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 529.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5±23.6 °C | |
Use of triptobenzene HTriptobenzene H (Hypoglic acid) significantly increases TNF-α and IL-1β mRNA levels in macrophages, causing indirect liver damage[1]. |
| Name | (4aS,10aS)-5-hydroxy-7-isopropyl-8-methoxy-1,4a-dimethyl-3,4,4a,9,10,10a-hexahydrophenanthrene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Triptobenzene H (Hypoglic acid) significantly increases TNF-α and IL-1β mRNA levels in macrophages, causing indirect liver damage[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.9±50.0 °C at 760 mmHg |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.44 |
| Flash Point | 184.5±23.6 °C |
| Exact Mass | 344.198761 |
| PSA | 66.76000 |
| LogP | 5.43 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | NZQIHCWNAMEWEW-KKSFZXQISA-N |
| SMILES | COc1c(C(C)C)cc(O)c2c1CCC1C(C)=C(C(=O)O)CCC21C |
| Hazard Codes | Xi |
|---|
| triptobenzene H |
| (4aS,10aS)-5-Hydroxy-7-isopropyl-8-methoxy-1,4a-dimethyl-3,4,4a,9,10,10a-hexahydro-2-phenanthrenecarboxylic acid |
| 2-Phenanthrenecarboxylic acid, 3,4,4a,9,10,10a-hexahydro-5-hydroxy-8-methoxy-1,4a-dimethyl-7-(1-methylethyl)-, (4aS,10aS)- |