Zaragozic acid B
Modify Date: 2025-08-25 21:10:03
Zaragozic acid B structure
|
Common Name | Zaragozic acid B | ||
|---|---|---|---|---|
| CAS Number | 146389-61-9 | Molecular Weight | 730.83800 | |
| Density | 1.3g/cm3 | Boiling Point | 871.6ºC at 760mmHg | |
| Molecular Formula | C39H54O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.4ºC | |
Use of Zaragozic acid BZaragozic acid B, a fungal metabolite, is a potent inhibitor of both farnesyl-protein transferase (FPTase) and squalene synthases. Zaragozic acid B is a potential anticancer drug[1]. |
| Name | 4,7-dihydroxy-1-[(E)-4-hydroxy-3,5-dimethyl-8-phenyloct-7-enyl]-6-[(6E,12E)-tetradeca-6,12-dienoyl]oxy-2,8-dioxabicyclo[3.2.1]octane-3,4,5-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Zaragozic acid B, a fungal metabolite, is a potent inhibitor of both farnesyl-protein transferase (FPTase) and squalene synthases. Zaragozic acid B is a potential anticancer drug[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Zaragozic acid B is a very potent inhibitor of squalene synthases from all three sources (RSS: rat liver microsome; YSS: Candida albicans; HSS: Hep G2 cells) with the IC50 values range from 0.22 to 0.67 nM[1]. Zaragozic acid B inhibits bovine FPTase (IC50=100 nM), human FPTase (IC50=185 nM)[1]. |
| References |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 871.6ºC at 760mmHg |
| Molecular Formula | C39H54O13 |
| Molecular Weight | 730.83800 |
| Flash Point | 260.4ºC |
| Exact Mass | 730.35600 |
| PSA | 217.35000 |
| LogP | 4.87800 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | VFZAKIFLDMCTJV-NZHUAJKLSA-N |
| SMILES | CC=CCCCCC=CCCCCC(=O)OC1C(O)C2(CCC(C)C(O)C(C)CC=Cc3ccccc3)OC(C(=O)O)C(O)(C(=O)O)C1(C(=O)O)O2 |
| Zaragozic acid B |