tert-butyldiphenylsilyl cyanide
Modify Date: 2025-08-25 16:27:17
tert-butyldiphenylsilyl cyanide structure
|
Common Name | tert-butyldiphenylsilyl cyanide | ||
|---|---|---|---|---|
| CAS Number | 145545-43-3 | Molecular Weight | 265.42500 | |
| Density | 1.017 g/mL at 25ºC(lit.) | Boiling Point | 136ºC0.7 mm Hg(lit.) | |
| Molecular Formula | C17H19NSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >110ºC | |
| Name | [tert-butyl(diphenyl)silyl]formonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.017 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 136ºC0.7 mm Hg(lit.) |
| Molecular Formula | C17H19NSi |
| Molecular Weight | 265.42500 |
| Flash Point | >110ºC |
| Exact Mass | 265.12900 |
| PSA | 23.79000 |
| LogP | 3.11248 |
| Vapour Pressure | 0.71 psi ( 55 °C) |
| Index of Refraction | n20/D 1.559(lit.) |
| InChIKey | ZJHNDMZEXWDAHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C#N)(c1ccccc1)c1ccccc1 |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | 23/24/25 |
| Safety Phrases | 36/37/39-45 |
| RIDADR | UN 3382 6.1/PG 1 |
| WGK Germany | 3 |
|
~86%
tert-butyldiphe... CAS#:145545-43-3 |
| Literature: Golinski, Miroslaw; Brock, Carolyn P.; Watt, David S. Journal of Organic Chemistry, 1993 , vol. 58, # 1 p. 159 - 164 |
| tert-Butyldiphenylsilyl cyanide |
| tert-Butyl(diphenyl)silanecarbonitrile |
| (1,1-dimethylethyl)diphenylsilyl cyanide |
| tert-Butyl-cyano-diphenylsilane |
| tert-Butyldiphenylsilylnitrile |