9H-Carbazole-3-carboxaldehyde,1,4-dimethyl- structure
|
Common Name | 9H-Carbazole-3-carboxaldehyde,1,4-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 14501-66-7 | Molecular Weight | 223.27000 | |
| Density | 1.238g/cm3 | Boiling Point | 445.7ºC at 760mmHg | |
| Molecular Formula | C15H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.1ºC | |
| Name | 1,4-dimethyl-9H-carbazole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 445.7ºC at 760mmHg |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27000 |
| Flash Point | 228.1ºC |
| Exact Mass | 223.10000 |
| PSA | 32.86000 |
| LogP | 3.75040 |
| Vapour Pressure | 3.87E-08mmHg at 25°C |
| Index of Refraction | 1.741 |
| InChIKey | XTIBCEUGIZGZHC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C=O)c(C)c2c1[nH]c1ccccc12 |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-formyl-1,4-dimethylcarbazole |
| 1,4 Dimethylcarbazol-3-carbaldehyde |
| 1,4-dimethyl-carbazole-3-carbaldehyde |
| 1,4-Dimethylcarbazol-3-carbaldehyd |
| 1,4-dimethylcarbazole-3-carboxaldehyde |