Cyclo(Phe-Val) structure
|
Common Name | Cyclo(Phe-Val) | ||
|---|---|---|---|---|
| CAS Number | 14474-71-6 | Molecular Weight | 246.30500 | |
| Density | 1.109g/cm3 | Boiling Point | 515.6ºC at 760mmHg | |
| Molecular Formula | C14H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4ºC | |
Use of Cyclo(Phe-Val)Antibacterial agent 134 (compound 1) is an diketopiperazine alkaloid with antimicrobial activity. Antibacterial agent 134 is the major metabolite in the culture of Hymeniacidon perleve associated bioactive bacterium Pseudomonas sp. NJ6-3-1[1]. |
| Name | 3-benzyl-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Antibacterial agent 134 (compound 1) is an diketopiperazine alkaloid with antimicrobial activity. Antibacterial agent 134 is the major metabolite in the culture of Hymeniacidon perleve associated bioactive bacterium Pseudomonas sp. NJ6-3-1[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 515.6ºC at 760mmHg |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.30500 |
| Flash Point | 210.4ºC |
| Exact Mass | 246.13700 |
| PSA | 65.18000 |
| LogP | 1.42010 |
| Vapour Pressure | 9.73E-11mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | OQQPOHUVAQPSHJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1NC(=O)C(Cc2ccccc2)NC1=O |
| HS Code | 2933599090 |
|---|
|
~%
Cyclo(Phe-Val) CAS#:14474-71-6 |
| Literature: Analytical Chemistry, , vol. 65, # 14 p. 1861 - 1867 |
|
~%
Cyclo(Phe-Val) CAS#:14474-71-6 |
| Literature: Analytical Chemistry, , vol. 65, # 14 p. 1861 - 1867 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-Piperazinedione,3-benzyl-6-isopropyl |
| Valyl-phenylalanyl-anhydrid |
| 3-Benzyl-6-isopropyl-piperazin-2,5-dion |
| 3-benzyl-6-isopropyl-piperazine-2,5-dione |
| c-L-Val-D-Phe |
| 3-Benzyl-6-isopropyl-2,5-piperazinedione |
| 3-Benzyl-6-isopropyl-2,5-dioxo-piperazin |