[5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)furan-2-yl]methanol structure
|
Common Name | [5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)furan-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 14470-43-0 | Molecular Weight | 268.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)furan-2-yl]methanol |
|---|
| Molecular Formula | C16H16N2O2 |
|---|---|
| Molecular Weight | 268.31000 |
| Exact Mass | 268.12100 |
| PSA | 61.19000 |
| LogP | 2.81710 |
| InChIKey | XFUCESSYKYEIQE-UHFFFAOYSA-N |
| SMILES | OCc1ccc(C2NCCc3c2[nH]c2ccccc32)o1 |
|
~%
[5-(2,3,4,9-tet... CAS#:14470-43-0 |
| Literature: Jeffreys,J.A.D. Journal of the Chemical Society [Section] C: Organic, 1970 , p. 1091 - 1103 |
|
~%
[5-(2,3,4,9-tet... CAS#:14470-43-0 |
| Literature: Jeffreys,J.A.D. Journal of the Chemical Society [Section] C: Organic, 1970 , p. 1091 - 1103 |
|
~%
[5-(2,3,4,9-tet... CAS#:14470-43-0 |
| Literature: Jeffreys,J.A.D. Journal of the Chemical Society [Section] C: Organic, 1970 , p. 1091 - 1103 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |