Sodium 4-ethynylbenzoate
Modify Date: 2025-09-02 11:22:01
Sodium 4-ethynylbenzoate structure
|
Common Name | Sodium 4-ethynylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 144693-65-2 | Molecular Weight | 168.12500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5NaO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | sodium,4-ethynylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5NaO2 |
|---|---|
| Molecular Weight | 168.12500 |
| Exact Mass | 168.01900 |
| PSA | 40.13000 |
| LogP | 0.03140 |
| InChIKey | VXBLAFDQGACQAR-UHFFFAOYSA-M |
| SMILES | C#Cc1ccc(C(=O)[O-])cc1.[Na+] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2916399090 |
|
~%
Sodium 4-ethyny... CAS#:144693-65-2 |
| Literature: Hale, Michael R.; Hill, Pamela; Lahiri, Sushmita; Miller, Matthew D.; Ross, Philip; Alm, Richard; Gao, Ning; Kutschke, Amy; Johnstone, Michele; Prince, Bryan; Thresher, Jason; Yang, Wei Bioorganic and Medicinal Chemistry Letters, 2013 , vol. 23, # 8 p. 2362 - 2367 |
|
~%
Sodium 4-ethyny... CAS#:144693-65-2 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 23, # 8 p. 2362 - 2367 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:728865-23-4| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD03426026 |
| sodium 4-ethynylbenzoate |
| sodium p-ethynylbenzoate |
| (4-carboxyphenyl)acetylene sodium salt |
| 4-ETHYNYLBENZOIC ACID SODIUM SALT |
| p-Ethynylbenzoic acid sodium salt |
| 4-Ethynylbenzoic acid sodium |