t-Butyl acetate-PEG3-CH2COOH
Modify Date: 2025-08-27 19:27:49
t-Butyl acetate-PEG3-CH2COOH structure
|
Common Name | t-Butyl acetate-PEG3-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 1442466-57-0 | Molecular Weight | 322.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of t-Butyl acetate-PEG3-CH2COOHt-Butyl acetate-PEG3-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | t-Butyl acetate-PEG3-CH2COOH |
|---|
| Description | t-Butyl acetate-PEG3-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H26O8 |
|---|---|
| Molecular Weight | 322.35 |
| InChIKey | AIRJXXFDTSVEAV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCC(=O)O |