5-(4-methoxyphenyl)-1H-indole structure
|
Common Name | 5-(4-methoxyphenyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 144104-46-1 | Molecular Weight | 223.27000 | |
| Density | 1.167g/cm3 | Boiling Point | 425.1ºC at 760 mmHg | |
| Molecular Formula | C15H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.4ºC | |
| Name | 5-(4-methoxyphenyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 425.1ºC at 760 mmHg |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27000 |
| Flash Point | 153.4ºC |
| Exact Mass | 223.10000 |
| PSA | 25.02000 |
| LogP | 3.84350 |
| Vapour Pressure | 4.88E-07mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | XGCLMZXVTHDCGI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc3[nH]ccc3c2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole,5-(4-methoxyphenyl) |
| 5-(p-methoxyphenyl)-1H-indole |
| 5-(4-Methoxy-phenyl)-1H-indole |
| 5-(4-METHOXYPHENYL)INDOLE |