5-(4-Methoxyphenyl)-1H-imidazol-2-amine structure
|
Common Name | 5-(4-Methoxyphenyl)-1H-imidazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 60472-20-0 | Molecular Weight | 189.21400 | |
| Density | 1.24g/cm3 | Boiling Point | 447.9ºC at 760 mmHg | |
| Molecular Formula | C10H11N3O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 224.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(4-Methoxyphenyl)-1H-imidazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 447.9ºC at 760 mmHg |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.21400 |
| Flash Point | 224.7ºC |
| Exact Mass | 189.09000 |
| PSA | 63.93000 |
| LogP | 2.24870 |
| Index of Refraction | 1.63 |
| InChIKey | LLAWLJKKTBJSEI-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cnc(N)[nH]2)cc1 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(4-Methoxyphenyl)-1H-iMidazol-2-aMine |