Triptoquinone B structure
|
Common Name | Triptoquinone B | ||
|---|---|---|---|---|
| CAS Number | 142937-50-6 | Molecular Weight | 330.418 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 475.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.4±25.2 °C | |
Use of Triptoquinone BTriptoquinone B ((+)-Triptoquinone B), a sesquiterpene alkaloid, is an interleukin-1 inhibitor. Triptoquinone B shows potent inhibitory activities against interleukin 1α and β releases for human peripheral mononuclear cells[1][2]. |
| Name | Triptoquinone B |
|---|---|
| Synonym | More Synonyms |
| Description | Triptoquinone B ((+)-Triptoquinone B), a sesquiterpene alkaloid, is an interleukin-1 inhibitor. Triptoquinone B shows potent inhibitory activities against interleukin 1α and β releases for human peripheral mononuclear cells[1][2]. |
|---|---|
| Related Catalog | |
| Target |
IL-1 |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 475.4±45.0 °C at 760 mmHg |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.418 |
| Flash Point | 255.4±25.2 °C |
| Exact Mass | 330.183105 |
| PSA | 71.44000 |
| LogP | 2.77 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | RYYRZMIBKOKIRO-UIAACRFSSA-N |
| SMILES | CC(C)C1=CC(=O)C2=C(CCC3C(C)(CO)C(=O)CCC23C)C1=O |
| Hazard Codes | Xi |
|---|
| 1,4,7(4bH)-Phenanthrenetrione, 5,6,8,8a,9,10-hexahydro-8-(hydroxymethyl)-4b,8-dimethyl-2-(1-methylethyl)-, (4bS,8S,8aR)- |
| 19-Hydroxyabieta-8,12-diene-3,11,14-trione |
| Triptoquinone B |