3,4-Didehydrosapriparaquione
Modify Date: 2025-08-25 16:55:53
3,4-Didehydrosapriparaquione structure
|
Common Name | 3,4-Didehydrosapriparaquione | ||
|---|---|---|---|---|
| CAS Number | 142763-37-9 | Molecular Weight | 312.40 | |
| Density | 1.1±0.0 g/cm3 | Boiling Point | 486.1±0.0 °C at 760 mmHg | |
| Molecular Formula | C20H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.9±0.0 °C | |
Use of 3,4-Didehydrosapriparaquione12-Hydroxysapriparaquinone (compound 8) is a rearranged 4,5-seco-abietane diterpenoid isolated from the petroleum ether extract of the root of Salvia rhytidea[1]. |
| Name | 3,4-Didehydrosapriparaquione |
|---|---|
| Synonym | More Synonyms |
| Description | 12-Hydroxysapriparaquinone (compound 8) is a rearranged 4,5-seco-abietane diterpenoid isolated from the petroleum ether extract of the root of Salvia rhytidea[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.0 g/cm3 |
|---|---|
| Boiling Point | 486.1±0.0 °C at 760 mmHg |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.40 |
| Flash Point | 261.9±0.0 °C |
| Exact Mass | 312.172546 |
| PSA | 54.37000 |
| LogP | 5.32 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | BLUCWOJJYVHVNH-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCc1c(C)ccc2c1C(=O)C(=O)C(C(C)C)=C2O |
| Hazard Codes | Xi |
|---|
| 1,4-Naphthalenedione, 3-hydroxy-6-methyl-2-(1-methylethyl)-5-(4-methyl-3-penten-1-yl)- |
| 3-Hydroxy-2-isopropyl-6-methyl-5-(4-methyl-3-penten-1-yl)-1,4-naphthoquinone |
| 3-Hydroxy-2-isopropyl-6-methyl-5-(4-methyl-3-pentenyl)naphthoquinone |