acetobromocellobiose structure
|
Common Name | acetobromocellobiose | ||
|---|---|---|---|---|
| CAS Number | 14227-66-8 | Molecular Weight | 699.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H35BrO17 | Melting Point | 191-193ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of acetobromocellobioseAcetobromocellobiose is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | acetobromocellobiose |
|---|---|
| Synonym | More Synonyms |
| Description | Acetobromocellobiose is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 191-193ºC |
|---|---|
| Molecular Formula | C26H35BrO17 |
| Molecular Weight | 699.45000 |
| Exact Mass | 698.10600 |
| PSA | 211.79000 |
| LogP | 0.00100 |
| InChIKey | NLFHLQWXGDPOME-VRECAULFSA-N |
| SMILES | CC(=O)OCC1OC(Br)C(OC(C)=O)C(OC(C)=O)C1OC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| 2,3,4,6-tetra-D-lactopyranosyl bromide |
| Benzenethiol,2,3,4,6-tetrachloro |
| 2,3,4,6-tetrachloro-thiophenol |
| 2,3,4,6-Tetrachlor-thiophenol |
| 2,3,4,6-Tetrachlorobenzolthiol |
| 2,3,4,6-tetrachloro-toluene |
| 2,3,4,6-Tetrachlor-toluol |
| peracetylated cellobiose bromide |
| 1,2,3,5-tetrachloro-4-methyl-benzene |