methyl 3-(4-methoxyphenyl)but-2-enoate structure
|
Common Name | methyl 3-(4-methoxyphenyl)but-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 142060-21-7 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-(4-methoxyphenyl)but-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 35.53000 |
| LogP | 2.27150 |
| InChIKey | ILUXKDLDTMIZIY-UHFFFAOYSA-N |
| SMILES | COC(=O)C=C(C)c1ccc(OC)cc1 |
|
~80%
methyl 3-(4-met... CAS#:142060-21-7 |
| Literature: Tetrahedron Letters, , vol. 44, # 46 p. 8487 - 8491 |
|
~%
methyl 3-(4-met... CAS#:142060-21-7 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 2 p. 435 - 445 |
| 3-<4'-Methoxy-phenyl>-but-2-en-saeure-methylester |