1,3-BIS(2,4,6-TRIMETHYLPHENYL)IMIDAZOLIUM CHLORIDE structure
|
Common Name | 1,3-BIS(2,4,6-TRIMETHYLPHENYL)IMIDAZOLIUM CHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 141556-45-8 | Molecular Weight | 340.89 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25ClN2 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 1,3-BIS(2,4,6-TRIMETHYLPHENYL)IMIDAZOLIUM CHLORIDE1,3-Dimesitylimidazolium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolium chloride |
|---|---|
| Synonym | More Synonyms |
| Description | 1,3-Dimesitylimidazolium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | >300 °C(lit.) |
|---|---|
| Molecular Formula | C21H25ClN2 |
| Molecular Weight | 340.89 |
| Exact Mass | 342.186279 |
| PSA | 8.81000 |
| LogP | 1.60840 |
| InChIKey | OTOSIXGMLYKKOW-UHFFFAOYSA-M |
| SMILES | Cc1cc(C)c(-n2cc[n+](-c3c(C)cc(C)cc3C)c2)c(C)c1.[Cl-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933290090 |
|
~90%
1,3-BIS(2,4,6-T... CAS#:141556-45-8 |
| Literature: Thomson, Jennifer E.; Campbell, Craig D.; Concellon, Carmen; Duguet, Nicolas; Rix, Kathryn; Slawin, Alexandra M. Z.; Smith, Andrew D. Journal of Organic Chemistry, 2008 , vol. 73, # 7 p. 2784 - 2791 |
|
~64%
1,3-BIS(2,4,6-T... CAS#:141556-45-8 |
| Literature: UNIVERSITY OF NEW ORLEANS RESEARCH AND TECHNOLOGY FOUNDATION, INC. Patent: WO2008/36084 A1, 2008 ; Location in patent: Page/Page column 4; 6; 7-8 ; |
|
~%
1,3-BIS(2,4,6-T... CAS#:141556-45-8 |
| Literature: Tetrahedron, , vol. 55, # 51 p. 14523 - 14534 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-DiMesityliMidazoliuM Chloride |
| 1,3-bis(2,4,6-trimethylphenyl)imidazol-1-ium,chloride |
| T5K CN AUTJ AR B1 D1 F1& CR B1 D1 F1 &&Chloride |
| 1,3-Bis(2,4,6-trimethylphenyl)imidazolium chloride |
| 1H-Imidazolium, 4,5-dihydro-1,3-bis(2,4,6-trimethylphenyl)-, chloride (1:1) |
| 1,3-Bis(2,4,6-trimethylphenyl)-4,5-dihydroimidazolium chloride |
| 4,5-Dihydro-1,3-bis(2,4,6-trimethylphenyl)-1H-imidazolium, chloride (1:1) |
| 1,3-Dimesityl-4,5-dihydro-1H-imidazol-3-ium chloride |
| 1,3-Dimesityl-1H-imidazol-3-ium chloride |
| MFCD02684541 |