Besifloxacin
Modify Date: 2025-08-21 18:44:13
Besifloxacin structure
|
Common Name | Besifloxacin | ||
|---|---|---|---|---|
| CAS Number | 141388-76-3 | Molecular Weight | 393.84 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 607.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H21ClFN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.9±31.5 °C | |
Use of BesifloxacinBesifloxacin is a fluoroquinolone antimicrobial agent. Besifloxacin can inhibit cytokine production by monocytes. Besifloxacin has broad-spectrum antibacterial activity[1]. |
| Name | 7-[(3R)-3-aminoazepan-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Besifloxacin is a fluoroquinolone antimicrobial agent. Besifloxacin can inhibit cytokine production by monocytes. Besifloxacin has broad-spectrum antibacterial activity[1]. |
|---|---|
| Related Catalog | |
| Target |
Bacteria[1] |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 607.0±55.0 °C at 760 mmHg |
| Molecular Formula | C19H21ClFN3O3 |
| Molecular Weight | 393.84 |
| Flash Point | 320.9±31.5 °C |
| Exact Mass | 393.125549 |
| PSA | 88.56000 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | QFFGVLORLPOAEC-SNVBAGLBSA-N |
| SMILES | NC1CCCCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2Cl)C1 |
| Storage condition | -20°C |
| Hazard Codes | Xn |
|---|
| QCR-76 |
| 7-[(3R)-3-Amino-1-azepanyl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylic acid |
| 3-Quinolinecarboxylic acid, 7-[(3R)-3-aminohexahydro-1H-azepin-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo- |
| Besifloxacin [INN] |
| BFE2NBZ7NX |
| UNII-BFE2NBZ7NX |
| Besivance |
| (R)-7-(3-Aminohexahydro-1H-azepin-1-yl)-8-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-3-quinolinecarboxylic acid |
| Besifloxacin |