Levatin
Modify Date: 2025-12-08 09:47:51
Levatin structure
|
Common Name | Levatin | ||
|---|---|---|---|---|
| CAS Number | 140670-84-4 | Molecular Weight | 328.35900 | |
| Density | 1.33g/cm3 | Boiling Point | 578.4ºC at 760mmHg | |
| Molecular Formula | C19H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.6ºC | |
Use of LevatinLevatin is an 18-Norclerodane diterpene from Croton levatii[1]. |
| Name | Levatin |
|---|
| Description | Levatin is an 18-Norclerodane diterpene from Croton levatii[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Claude Moulis, et al. Levatin, an 18-Norclerodane Diterpene from Croton levatii. |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 578.4ºC at 760mmHg |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.35900 |
| Flash Point | 303.6ºC |
| Exact Mass | 328.13100 |
| PSA | 65.74000 |
| LogP | 3.31590 |
| Vapour Pressure | 2.24E-13mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | UNKJMPBJRRFBEL-MMMABECUSA-N |
| SMILES | C=C1CCC23CC(CCC2C12CC(c1ccoc1)OC2=O)OC3=O |
| Hazard Codes | Xn |
|---|