GSK2646264 structure
|
Common Name | GSK2646264 | ||
|---|---|---|---|---|
| CAS Number | 1398695-47-0 | Molecular Weight | 374.48 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 517.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.7±30.1 °C | |
Use of GSK2646264GSK2646264 (Compound 44) is a potent and selective spleen tyrosine kinase (SYK) inhibitor with a pIC50 of 7.1. GSK2646264 also inhibits other kinases with pIC50 values of 5.4, 5.4, 5.3, 5, 4.5, <4.6 and <4.3 against LCK, LRRK2, GSK3β, JAK2, VEGFR2, Aurora B and Aurora A, respectively. GSK2646264 is penetrable into the epidermis and dermis of the skin[1]. |
| Name | GSK2646264 |
|---|---|
| Synonym | More Synonyms |
| Description | GSK2646264 (Compound 44) is a potent and selective spleen tyrosine kinase (SYK) inhibitor with a pIC50 of 7.1. GSK2646264 also inhibits other kinases with pIC50 values of 5.4, 5.4, 5.3, 5, 4.5, <4.6 and <4.3 against LCK, LRRK2, GSK3β, JAK2, VEGFR2, Aurora B and Aurora A, respectively. GSK2646264 is penetrable into the epidermis and dermis of the skin[1]. |
|---|---|
| Related Catalog | |
| Target |
SYK:7.1 (pIC50) LCK:5.4 (pIC50) LRRK2:5.4 (pIC50) GSK3β:5.3 (pIC50) JAK2:5 (pIC50) VEGFR2:4.5 (pIC50) Aurora B:<4.6 (pIC50) Aurora A:<4.3 (pIC50) |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.4±50.0 °C at 760 mmHg |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 |
| Flash Point | 266.7±30.1 °C |
| Exact Mass | 374.199432 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | KYANYGKXMNYFBX-UHFFFAOYSA-N |
| SMILES | COc1cccc(OCc2cc(C)ccn2)c1-c1ccc2c(c1)CCNCC2 |
| 7-{2-Methoxy-6-[(4-methyl-2-pyridinyl)methoxy]phenyl}-2,3,4,5-tetrahydro-1H-3-benzazepine |
| 1H-3-Benzazepine, 2,3,4,5-tetrahydro-7-[2-methoxy-6-[(4-methyl-2-pyridinyl)methoxy]phenyl]- |