DS-3032b
Modify Date: 2025-08-25 18:12:50
DS-3032b structure
|
Common Name | DS-3032b | ||
|---|---|---|---|---|
| CAS Number | 1398568-47-2 | Molecular Weight | 618.526 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 840.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C30H34Cl2FN5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 462.2±34.3 °C | |
Use of DS-3032bMliademetan is a specific MDM2 inhibitor, a pharmaceutical composition for use in treating acute myeloid leukemia (AML). |
| Name | milademetan |
|---|---|
| Synonym | More Synonyms |
| Description | Mliademetan is a specific MDM2 inhibitor, a pharmaceutical composition for use in treating acute myeloid leukemia (AML). |
|---|---|
| Related Catalog | |
| Target |
MDM2[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 840.7±65.0 °C at 760 mmHg |
| Molecular Formula | C30H34Cl2FN5O4 |
| Molecular Weight | 618.526 |
| Flash Point | 462.2±34.3 °C |
| Exact Mass | 617.197205 |
| LogP | 3.54 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | RYAYYVTWKAOAJF-QISPRATLSA-N |
| SMILES | CC1(C)CCC2(CC1)NC(C(=O)NC1CCC(C(N)=O)OC1)C(c1ccnc(Cl)c1F)C21C(=O)Nc2cc(Cl)ccc21 |
| Storage condition | 2-8℃ |
| R3I80TLN7S |
| DS-3032 |
| milademetan |