Methyl 1-((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1H-benzo[d]imidazole-7-carboxylate structure
|
Common Name | Methyl 1-((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1H-benzo[d]imidazole-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 139481-44-0 | Molecular Weight | 411.453 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 630.4±65.0 °C at 760 mmHg | |
| Molecular Formula | C25H21N3O3 | Melting Point | 168 °C | |
| MSDS | N/A | Flash Point | 335.1±34.3 °C | |
| Name | Methyl 1-((2'-cyano-[1,1'-biphenyl]-4-yl)methyl)-2-ethoxy-1H-benzo[d]imidazole-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 630.4±65.0 °C at 760 mmHg |
| Melting Point | 168 °C |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.453 |
| Flash Point | 335.1±34.3 °C |
| Exact Mass | 411.158295 |
| PSA | 77.14000 |
| LogP | 5.45 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | KSXLHOFDCDKQLH-UHFFFAOYSA-N |
| SMILES | CCOc1nc2cccc(C(=O)OC)c2n1Cc1ccc(-c2ccccc2C#N)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 1-[(2'-cyanobiphenyl-4-yl)methyl]-2-ethoxy-1H-benzimidazole-7-carboxylate |
| T56 BN DNJ B1R DR BCN&& CO2 IVO1 |
| methyl 3-[[4-(2-cyanophenyl)phenyl]methyl]-2-ethoxybenzimidazole-4-carboxylate |
| Methyl 1-[(2'-cyano-4-biphenylyl)methyl]-2-ethoxy-1H-benzimidazole-7-carboxylate |
| 1H-Benzimidazole-7-carboxylic acid, 1-[(2'-cyano[1,1'-biphenyl]-4-yl)methyl]-2-ethoxy-, methyl ester |
| 1H-benzimidazole-7-carboxylicacid,1-[(2-cyano-[1,1’-biphenyl]-4-yl)methyl]-2-ethoxy-,methyl ester |
| METHYL 1-(2'-CYANOBIPHENYL-4-YL)METHYL-2-ETHOXY BENZIMIDAZOLE-7-CARBOXYLATE(EBC-II) |