4'-azidouridine
Modify Date: 2025-09-19 11:40:13
4'-azidouridine structure
|
Common Name | 4'-azidouridine | ||
|---|---|---|---|---|
| CAS Number | 139442-01-6 | Molecular Weight | 285.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4'-azidouridine4'-C-azidouridine (4'-Azidouridine) is a uridine analogue. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
| Name | 1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 4'-C-azidouridine (4'-Azidouridine) is a uridine analogue. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C9H11N5O6 |
|---|---|
| Molecular Weight | 285.21 |
| Exact Mass | 285.070923 |
| PSA | 174.79000 |
| LogP | -0.25 |
| InChIKey | FHPJZSIIXUQGQE-JVZYCSMKSA-N |
| SMILES | [N-]=[N+]=NC1(CO)OC(n2ccc(=O)[nH]c2=O)C(O)C1O |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:812647-80-6
CAS#:14365-63-0
CAS#:478182-28-4| 1-[(2R,3R,4S,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]pyrimidine-2,4(1H,3H)-dione (non-preferred name) |
| 4'-azidouridine |
| 4'-azido-uridine |
| 1-[(2R,3R,4S,5R)-5-Azido-3,4-dihydroxy-5-(hydroxymethyl)tetrahydro-2-furanyl]-2,4(1H,3H)-pyrimidinedione |
| 4'-AzU |
| Uridine,4'-C-azido |
| 1-((2R,3R,4S,5R)-5-Azido-3,4-dihydroxy-5-hydroxymethyl-tetrahydro-furan-2-yl)-1H-pyrimidine-2,4-dione |