Coronarin D ethyl ether structure
|
Common Name | Coronarin D ethyl ether | ||
|---|---|---|---|---|
| CAS Number | 138965-89-6 | Molecular Weight | 346.504 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 460.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.8±23.3 °C | |
Use of Coronarin D ethyl etherEthoxycoronarin D is a labdane diterpenes compound isolated from rhizomes. Ethoxycoronarin D selectively inhibits COX-1 with an IC50 of 3.8 µM[1]. |
| Name | (3E)-5-Ethoxy-3-{2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylenedeca hydro-1-naphthalenyl]ethylidene}dihydro-2(3H)-furanone |
|---|---|
| Synonym | More Synonyms |
| Description | Ethoxycoronarin D is a labdane diterpenes compound isolated from rhizomes. Ethoxycoronarin D selectively inhibits COX-1 with an IC50 of 3.8 µM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 460.6±45.0 °C at 760 mmHg |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.504 |
| Flash Point | 197.8±23.3 °C |
| Exact Mass | 346.250793 |
| PSA | 35.53000 |
| LogP | 6.18 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | HUJJMXMBEMUVOX-WOYMVRNGSA-N |
| SMILES | C=C1CCC2C(C)(C)CCCC2(C)C1CC=C1CC(OCC)OC1=O |
| Hazard Codes | Xi |
|---|
| coronarin-D ethyl ether |
| 2(3H)-Furanone, 3-[2-[(1S,4aS,8aS)-decahydro-5,5,8a-trimethyl-2-methylene-1-naphthalenyl]ethylidene]-5-ethoxydihydro-, (3E)- |
| coronarin B |
| (3E)-5-Ethoxy-3-{2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylenedecahydro-1-naphthalenyl]ethylidene}dihydro-2(3H)-furanone |