(E)-(2-Nitro-1-heptenyl)cyclohexane
Modify Date: 2025-09-16 15:42:57
(E)-(2-Nitro-1-heptenyl)cyclohexane structure
|
Common Name | (E)-(2-Nitro-1-heptenyl)cyclohexane | ||
|---|---|---|---|---|
| CAS Number | 138668-20-9 | Molecular Weight | 225.32700 | |
| Density | 1.019g/cm3 | Boiling Point | 330.5ºC at 760mmHg | |
| Molecular Formula | C13H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.2ºC | |
| Name | 2-nitrohept-1-enylcyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 330.5ºC at 760mmHg |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.32700 |
| Flash Point | 135.2ºC |
| Exact Mass | 225.17300 |
| PSA | 45.82000 |
| LogP | 4.83080 |
| Vapour Pressure | 0.000318mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | KTLANCLSASGCKY-ACCUITESSA-N |
| SMILES | CCCCCC(=CC1CCCCC1)[N+](=O)[O-] |
|
~%
(E)-(2-Nitro-1-... CAS#:138668-20-9 |
| Literature: Ballini, Roberto; Castagnani, Roberto; Petrini, Marino Journal of Organic Chemistry, 1992 , vol. 57, # 7 p. 2160 - 2162 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (E)-(2-Nitro-1-heptenyl)cyclohexane |
| Cyclohexane,(2-nitro-1-heptenyl)-,(E)-(9CI) |
| (E)-2-nitro-1-cyclohexyl-1-heptene |