4-chloro-N-[(E)-2-nitro-1-phenyl-ethenyl]aniline structure
|
Common Name | 4-chloro-N-[(E)-2-nitro-1-phenyl-ethenyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 55577-69-0 | Molecular Weight | 274.70200 | |
| Density | 1.334g/cm3 | Boiling Point | 411.6ºC at 760 mmHg | |
| Molecular Formula | C14H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.7ºC | |
| Name | 4-chloro-N-[(E)-2-nitro-1-phenylethenyl]aniline |
|---|
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 411.6ºC at 760 mmHg |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.70200 |
| Flash Point | 202.7ºC |
| Exact Mass | 274.05100 |
| PSA | 57.85000 |
| LogP | 4.62340 |
| Index of Refraction | 1.662 |
| InChIKey | CAOSYRKMWGPGQA-GXDHUFHOSA-N |
| SMILES | O=[N+]([O-])C=C(Nc1ccc(Cl)cc1)c1ccccc1 |
|
~%
4-chloro-N-[(E)... CAS#:55577-69-0 |
| Literature: Perrot; Berger Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1952 , vol. 235, p. 185 |
|
~%
4-chloro-N-[(E)... CAS#:55577-69-0 |
| Literature: Perrot; Berger Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1952 , vol. 235, p. 185 |
|
~%
4-chloro-N-[(E)... CAS#:55577-69-0 |
| Literature: Rappoport,Z.; Hoz,S. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1975 , p. 272 - 277 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |