Pomolic acid structure
|
Common Name | Pomolic acid | ||
|---|---|---|---|---|
| CAS Number | 13849-91-7 | Molecular Weight | 472.700 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 586.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.4±26.6 °C | |
Use of Pomolic acidRandialic acid A (Pomolic acid) is a pentacyclic triterpene isolated from Euscaphis japonica (Tunb.). Randialic acid A (Pomolic acid) inhibits tumor cells growth and induces cell apoptosis. Randialic acid A (Pomolic acid) has a potential for the treatment of prostate cancer (PC)[2]. |
| Name | pomolic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Randialic acid A (Pomolic acid) is a pentacyclic triterpene isolated from Euscaphis japonica (Tunb.). Randialic acid A (Pomolic acid) inhibits tumor cells growth and induces cell apoptosis. Randialic acid A (Pomolic acid) has a potential for the treatment of prostate cancer (PC)[2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: apoptosis[1] |
| In Vitro | Randialic acid A (Pomolic acid) induces apoptosis of GBM cells as demonstrated by DNA fragmentation. Pomolic acid-induced apoptosis is dependent on reactive oxygen species (ROS) production. It also induces uncoupling of mitochondria membrane potential and activation of caspase-3 and -9[2]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 586.2±50.0 °C at 760 mmHg |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.700 |
| Flash Point | 322.4±26.6 °C |
| Exact Mass | 472.355255 |
| PSA | 76.66000 |
| LogP | 7.40 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | ZZTYPLSBNNGEIS-OPAXANQDSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1(C)O |
| Hazard Codes | Xi |
|---|
| Benthamic acid |
| 3β,19-Dihydroxy-5α-urs-12-en-28-oic acid |
| Urs-12-en-28-oic acid, 3,19-dihydroxy-, (3β)- |
| (3β)-3,19-Dihydroxyurs-12-en-28-oic acid |
| Randialic acid A |
| 3β,19α-Dihydroxyurs-12-ene-28-oic acid |
| 3β,19-Dihydroxyurs-12-en-28-oic acid |
| (1R,2R,4aS,6aS,6bR,8aR,10S,12aR,12bR,14bS)-1,10-dihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-4a-carboxylic acid |
| Serazide |